carmi13 carmi13

10-01-2024
Mathematics

contestada

The adjasent side of a right angle triangle is 10 and the opposite side is x and the tan is 33.8. Find x

Respuesta :

Otras preguntas

The three vehicles shown below are all traveling at a speed of 15 m/s. The third car in line has a mass of 1200kg. The red car has a mass of 1500kg. Subtract th

How was the hundredth tiger killed

complete the dialogue between beti and carman with the correct form of the verbin parentheses apex 1.1.5

Find the volume of a cone that has a radius of 3 inches and the height of 4 inches

3 C2H3O2H+Al(OH)3-Al(C2H3O2)3+H2O Determine the mass of aluminum acetated that can be made if this reaction with 125 grams of acetic acid and 275 gram of alumin

1.87 moles to magnesium iodide

what will be the potential energy of a body if it's mass is 30 kg and located 30 m high from the ground?

a four digit number has digit form "a4bz". if it is divisible by 3, what are the possible value of a+b?

Which reactions are involved in the process of photosyenthesis

Perhatikan tabel 3.2 jika sebuah bimetal dibuat dari bahan tembaga dan kuningan gambarkanlah kemana kelengkungan lempeng bimetal tersebut