630305673 630305673

08-01-2021
Mathematics

contestada

HELP ASAP
The function f(n) = 3n + 19 represents an arithmetic sequence. What is
the 32nd term of the sequence? *

Respuesta :

ChoiSungHyun ChoiSungHyun

08-01-2021

Step-by-step explanation:

f(n) = 3n + 19

When n = 32, f(32) = 3(32) + 19 = 96 + 19 = 115.

The 32nd term of the AP is 115.

Answer Link

Otras preguntas

Characteristics of just-in-time partnerships do not include: a.focus on core competencies. b.removal of in-transit inventory. c.long-term contracts. d.large lot

In photosynthesis what are the 2 major reaction that take place?

Find the exact value of csc(-1860). Not exactly for sure where to start, i've gotten to this, csc(300)=csc(360-60)=csc(-60) but I am not for sure where to go a

Holders of common stock receive certain benefits, such as a residual claim, which is the

Explain some of the processes that may be involved in a scientific investigation such as experimentation analysis

8 less than the quotient of 42 and a number?

Raja is studying family change and is focusing on age-related transitions that are socially produced, socially recognized, and shared. he sees aging as a lifelo

Which sentence contains an error in word usage? a.The magician's black dress complemented the white decor of the ballroom perfectly. b.When someone pays you a

In which of the following ways did Soviet women differ from American women in their involvement in World War II? A. American women worked in factories.

Explain the steps for dividing decimals. Write three or four sentences.