KielieCooper KielieCooper

07-11-2022
Mathematics

contestada

tan(x+pie) + sin(x+pie) + sin (x-pie) = 0

Respuesta :

emmymaster3 emmymaster3

07-11-2022

Answer:Use the identity: sin(A+B) = sin(A)cos(B)+cos(A)sin(B) Substitute x for A and pi for B: sin(x+pi) = sin(x)cos(pi)+cos(x)sin(pi) The second term disappears, ...

Step-by-step explanation:

Answer Link

Otras preguntas

A health club charges $35 a month for membership fees. Determine whether the cost of membership is proportional to the number of months. Explain your reasoning.

what is 25,344 divided by 5,280

Which of the following plurals is incorrect? A. Agencys B. Labels C. Halves D. Factories

Select the largest, most inclusive biological level from the following choices. a. Cell b. Organ c. Molecule d. Tissue

how to use biome in a sentence

Advantages of having a small family

How would franklin's albany plan of union have changed colonial government answer join or die by Benjamin franklin

U.S. President Woodrow Wilson was the founder of the League of Nations. How justified is the statement?

During the Stone Age, people invented tools such as daggers, spear points, and hand axes, and made them mostly out of stone. a. True b. False

who controlled the roads leading from yorktown to the west