smitty13 smitty13

07-05-2017
Mathematics

contestada

5,ooo invested 5 years 3% interest compounded continuously

Respuesta :

Aliwohaish12 Aliwohaish12

07-05-2017

A=pe^rt

A future value
P principle 5000
R interest rate 3/100 =0.03
T time 5 years

A=5,000×e^(0.03×5)
A=5,809.17

Answer Link

Otras preguntas

Example 2 Five steps of a proof are shown. Write the reasons for each statement. Given A4BC Prove m/1+mZ2+ m23 = 180° STATEMENTS 1. AABC 2. Draw BD parallel to

Use a ruler and compasses in this question. ABCD represents a garden. A 1 7 2 Identify all the possible positions (1 to 9) for the bench. Show all your construc

Drag and drop the numbers and phrases to complete the sentence.

Why might Jordan start to feel better in the darkness of the park, while looking at the stars? Use at least two pieces of evidence from the text to support your

What are common devices used in health care that put patient information at risk

Give an example of how microplastics could end up on a consumer's plate? Your plate!

3 C2H3O2H+Al(OH)3-Al(C2H3O2)3+H2O Determine the mass of aluminum acetated that can be made if this reaction with 125 grams of acetic acid and 275 gram of alumin

if Steve throws the football 50 meters 3seconds, what’s the average sped (velocity) of the football?

27. A hemispherical and a conical hole is scooped out of a solid wooden cylinder. Find the volume of the remaining solid where the measurements are as follows:

What were the inherent causes of the American Revolution